C12H17BClNO4 — CID 59463172
[4-chloro-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid (PubChem CID 59463172) has the molecular formula C12H17BClNO4 and a molecular weight of 285.54 g/mol. Its IUPAC name is [4-chloro-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid.
| Compound Name | [4-chloro-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 59463172 |
| Molecular Formula | C12H17BClNO4 |
| Molecular Weight | 285.54 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | [4-chloro-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)NCc1cc(Cl)ccc1B(O)O |
| InChI | InChI=1S/C12H17BClNO4/c1-12(2,3)19-11(16)15-7-8-6-9(14)4-5-10(8)13(17)18/h4-6,17-18H,7H2,1-3H3,(H,15,16) |
| InChIKey | SGDVIYAZICBURS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.54 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|