C12H15ClFNO2 — CID 137347631
tert-butyl N-[(2-chloro-3-fluorophenyl)methyl]carbamate (PubChem CID 137347631) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is tert-butyl N-[(2-chloro-3-fluorophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2-chloro-3-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 137347631 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | tert-butyl N-[(2-chloro-3-fluorophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(F)c1Cl |
| InChI | InChI=1S/C12H15ClFNO2/c1-12(2,3)17-11(16)15-7-8-5-4-6-9(14)10(8)13/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | ULAYEHIAIXECJA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |