C13H15F4NO2 — CID 86617534
tert-butyl N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 86617534) has the molecular formula C13H15F4NO2 and a molecular weight of 293.26 g/mol. Its IUPAC name is tert-butyl N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 86617534 |
| Molecular Formula | C13H15F4NO2 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | tert-butyl N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C13H15F4NO2/c1-12(2,3)20-11(19)18-7-8-5-4-6-9(10(8)14)13(15,16)17/h4-6H,7H2,1-3H3,(H,18,19) |
| InChIKey | ZINQJVWWSHNLTP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |