C10H8ClF4NO — CID 162625143
2-chloro-N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 162625143) has the molecular formula C10H8ClF4NO and a molecular weight of 269.63 g/mol. Its IUPAC name is 2-chloro-N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-chloro-N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 162625143 |
| Molecular Formula | C10H8ClF4NO |
| Molecular Weight | 269.63 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 2-chloro-N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(CCl)NCc1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C10H8ClF4NO/c11-4-8(17)16-5-6-2-1-3-7(9(6)12)10(13,14)15/h1-3H,4-5H2,(H,16,17) |
| InChIKey | JDYMVCQRPNEUPA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.63 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|