C15H14F4N4O — CID 154822152
N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide (PubChem CID 154822152) has the molecular formula C15H14F4N4O and a molecular weight of 342.30 g/mol. Its IUPAC name is N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide.
| Compound Name | N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 154822152 |
| Molecular Formula | C15H14F4N4O |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1F)C1CCc2ncnn2C1 |
| InChI | InChI=1S/C15H14F4N4O/c16-13-9(2-1-3-11(13)15(17,18)19)6-20-14(24)10-4-5-12-21-8-22-23(12)7-10/h1-3,8,10H,4-7H2,(H,20,24) |
| InChIKey | ZPQFLMXQEPBSNJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |