C10H17N5O3S — CID 154822643
N-[2-(methylsulfamoyl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide (PubChem CID 154822643) has the molecular formula C10H17N5O3S and a molecular weight of 287.35 g/mol. Its IUPAC name is N-[2-(methylsulfamoyl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide.
| Compound Name | N-[2-(methylsulfamoyl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 154822643 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-[2-(methylsulfamoyl)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)C1CCc2ncnn2C1 |
| InChI | InChI=1S/C10H17N5O3S/c1-11-19(17,18)5-4-12-10(16)8-2-3-9-13-7-14-15(9)6-8/h7-8,11H,2-6H2,1H3,(H,12,16) |
| InChIKey | XXILJGYDXXQGBP-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |