C15H20N6O2S — CID 133281602
N-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 133281602) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | N-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 133281602 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | O=S(=O)(c1ccc(NC2CCc3ncnn3C2)nc1)N1CCCC1 |
| InChI | InChI=1S/C15H20N6O2S/c22-24(23,20-7-1-2-8-20)13-4-5-14(16-9-13)19-12-3-6-15-17-11-18-21(15)10-12/h4-5,9,11-12H,1-3,6-8,10H2,(H,16,19) |
| InChIKey | QLYALHFIJFOYIQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |