C11H16N4O3S — CID 8567255
2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]acetamide (PubChem CID 8567255) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]acetamide.
| Compound Name | 2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 8567255 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]acetamide |
| SMILES | NC(=O)CNc1ccc(S(=O)(=O)N2CCCC2)cn1 |
| InChI | InChI=1S/C11H16N4O3S/c12-10(16)8-14-11-4-3-9(7-13-11)19(17,18)15-5-1-2-6-15/h3-4,7H,1-2,5-6,8H2,(H2,12,16)(H,13,14) |
| InChIKey | NTWXPRHAERWWNF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |