C14H23N3O4S — CID 4792805
2-[2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]ethoxy]ethanol (PubChem CID 4792805) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-[2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 4792805 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]ethoxy]ethanol |
| SMILES | O=S(=O)(c1ccc(NCCOCCO)nc1)N1CCCCC1 |
| InChI | InChI=1S/C14H23N3O4S/c18-9-11-21-10-6-15-14-5-4-13(12-16-14)22(19,20)17-7-2-1-3-8-17/h4-5,12,18H,1-3,6-11H2,(H,15,16) |
| InChIKey | YEAYOMSGCXMLRJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|