C18H29N3O3S — CID 133308701
N-(2-cycloheptyloxyethyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine (PubChem CID 133308701) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is N-(2-cycloheptyloxyethyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-(2-cycloheptyloxyethyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 133308701 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-(2-cycloheptyloxyethyl)-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(NCCOC2CCCCCC2)nc1)N1CCCC1 |
| InChI | InChI=1S/C18H29N3O3S/c22-25(23,21-12-5-6-13-21)17-9-10-18(20-15-17)19-11-14-24-16-7-3-1-2-4-8-16/h9-10,15-16H,1-8,11-14H2,(H,19,20) |
| InChIKey | HERYWIUTKXKNHW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|