C17H28N4O3S — CID 133281384
2-[4-[[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]methyl]piperidin-1-yl]ethanol (PubChem CID 133281384) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[4-[[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]methyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 133281384 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-[4-[[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]methyl]piperidin-1-yl]ethanol |
| SMILES | O=S(=O)(c1ccc(NCC2CCN(CCO)CC2)nc1)N1CCCC1 |
| InChI | InChI=1S/C17H28N4O3S/c22-12-11-20-9-5-15(6-10-20)13-18-17-4-3-16(14-19-17)25(23,24)21-7-1-2-8-21/h3-4,14-15,22H,1-2,5-13H2,(H,18,19) |
| InChIKey | VGXBLFDBQLNNLP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |