C16H26N4O3S — CID 9024930
N-tert-butyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]acetamide (PubChem CID 9024930) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-tert-butyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 9024930 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-tert-butyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]acetamide |
| SMILES | CC(C)(C)NC(=O)CNc1ccc(S(=O)(=O)N2CCCCC2)cn1 |
| InChI | InChI=1S/C16H26N4O3S/c1-16(2,3)19-15(21)12-18-14-8-7-13(11-17-14)24(22,23)20-9-5-4-6-10-20/h7-8,11H,4-6,9-10,12H2,1-3H3,(H,17,18)(H,19,21) |
| InChIKey | CGGKHNLEPHSEMC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |