C17H27N5O3S — CID 55365489
3-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 55365489) has the molecular formula C17H27N5O3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 3-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 55365489 |
| Molecular Formula | C17H27N5O3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 3-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NCCC(=O)N3CCCC3)nc2)CC1 |
| InChI | InChI=1S/C17H27N5O3S/c1-20-10-12-22(13-11-20)26(24,25)15-4-5-16(19-14-15)18-7-6-17(23)21-8-2-3-9-21/h4-5,14H,2-3,6-13H2,1H3,(H,18,19) |
| InChIKey | FQOSGMPLNLETIM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |