C20H28N4O3S — CID 133495668
4-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]-2-phenylbutan-2-ol (PubChem CID 133495668) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is 4-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]-2-phenylbutan-2-ol.
| Compound Name | 4-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]-2-phenylbutan-2-ol |
|---|---|
| PubChem CID | 133495668 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 4-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]-2-phenylbutan-2-ol |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NCCC(C)(O)c3ccccc3)nc2)CC1 |
| InChI | InChI=1S/C20H28N4O3S/c1-20(25,17-6-4-3-5-7-17)10-11-21-19-9-8-18(16-22-19)28(26,27)24-14-12-23(2)13-15-24/h3-9,16,25H,10-15H2,1-2H3,(H,21,22) |
| InChIKey | KJGCAYGGAYEHND-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |