C21H29N3O5S — CID 55829206
2-[2-methoxy-4-[1-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]ethyl]phenoxy]ethanol (PubChem CID 55829206) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-[2-methoxy-4-[1-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]ethyl]phenoxy]ethanol.
| Compound Name | 2-[2-methoxy-4-[1-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]ethyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 55829206 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-[2-methoxy-4-[1-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]ethyl]phenoxy]ethanol |
| SMILES | COc1cc(C(C)Nc2ccc(S(=O)(=O)N3CCCCC3)cn2)ccc1OCCO |
| InChI | InChI=1S/C21H29N3O5S/c1-16(17-6-8-19(29-13-12-25)20(14-17)28-2)23-21-9-7-18(15-22-21)30(26,27)24-10-4-3-5-11-24/h6-9,14-16,25H,3-5,10-13H2,1-2H3,(H,22,23) |
| InChIKey | OJIJASMDHCPLEU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |