C20H27N3O6S — CID 55829205
2-[2-methoxy-4-[1-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)amino]ethyl]phenoxy]ethanol (PubChem CID 55829205) has the molecular formula C20H27N3O6S and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-[2-methoxy-4-[1-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)amino]ethyl]phenoxy]ethanol.
| Compound Name | 2-[2-methoxy-4-[1-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)amino]ethyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 55829205 |
| Molecular Formula | C20H27N3O6S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-[2-methoxy-4-[1-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)amino]ethyl]phenoxy]ethanol |
| SMILES | COc1cc(C(C)Nc2ccc(S(=O)(=O)N3CCOCC3)cn2)ccc1OCCO |
| InChI | InChI=1S/C20H27N3O6S/c1-15(16-3-5-18(29-12-9-24)19(13-16)27-2)22-20-6-4-17(14-21-20)30(25,26)23-7-10-28-11-8-23/h3-6,13-15,24H,7-12H2,1-2H3,(H,21,22) |
| InChIKey | UUKPEGDRBJDEEP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |