C20H27N3O3S — CID 9107195
5-morpholin-4-ylsulfonyl-N-[2-(4-propan-2-ylphenyl)ethyl]pyridin-2-amine (PubChem CID 9107195) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonyl-N-[2-(4-propan-2-ylphenyl)ethyl]pyridin-2-amine.
| Compound Name | 5-morpholin-4-ylsulfonyl-N-[2-(4-propan-2-ylphenyl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 9107195 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 5-morpholin-4-ylsulfonyl-N-[2-(4-propan-2-ylphenyl)ethyl]pyridin-2-amine |
| SMILES | CC(C)c1ccc(CCNc2ccc(S(=O)(=O)N3CCOCC3)cn2)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-16(2)18-5-3-17(4-6-18)9-10-21-20-8-7-19(15-22-20)27(24,25)23-11-13-26-14-12-23/h3-8,15-16H,9-14H2,1-2H3,(H,21,22) |
| InChIKey | PYWACAJXMMOLSC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |