C17H19F2N3O3S — CID 84929926
N-[1-(3,4-difluorophenyl)ethyl]-5-morpholin-4-ylsulfonylpyridin-2-amine (PubChem CID 84929926) has the molecular formula C17H19F2N3O3S and a molecular weight of 383.42 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-5-morpholin-4-ylsulfonylpyridin-2-amine.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-5-morpholin-4-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 84929926 |
| Molecular Formula | C17H19F2N3O3S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-5-morpholin-4-ylsulfonylpyridin-2-amine |
| SMILES | CC(Nc1ccc(S(=O)(=O)N2CCOCC2)cn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H19F2N3O3S/c1-12(13-2-4-15(18)16(19)10-13)21-17-5-3-14(11-20-17)26(23,24)22-6-8-25-9-7-22/h2-5,10-12H,6-9H2,1H3,(H,20,21) |
| InChIKey | CSENCTXORQERQF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |