C20H27N3O2S2 — CID 133287490
N-[1-(4-propan-2-ylsulfanylphenyl)ethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine (PubChem CID 133287490) has the molecular formula C20H27N3O2S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is N-[1-(4-propan-2-ylsulfanylphenyl)ethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-[1-(4-propan-2-ylsulfanylphenyl)ethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 133287490 |
| Molecular Formula | C20H27N3O2S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[1-(4-propan-2-ylsulfanylphenyl)ethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
| SMILES | CC(C)Sc1ccc(C(C)Nc2ccc(S(=O)(=O)N3CCCC3)cn2)cc1 |
| InChI | InChI=1S/C20H27N3O2S2/c1-15(2)26-18-8-6-17(7-9-18)16(3)22-20-11-10-19(14-21-20)27(24,25)23-12-4-5-13-23/h6-11,14-16H,4-5,12-13H2,1-3H3,(H,21,22) |
| InChIKey | JSKOADPFFXBMFY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |