C20H31N5O2S — CID 133477635
N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-piperidin-1-ylsulfonylpyridin-2-amine (PubChem CID 133477635) has the molecular formula C20H31N5O2S and a molecular weight of 405.57 g/mol. Its IUPAC name is N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-piperidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-piperidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 133477635 |
| Molecular Formula | C20H31N5O2S |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-piperidin-1-ylsulfonylpyridin-2-amine |
| SMILES | Cc1nn(C(C)(C)C)cc1C(C)Nc1ccc(S(=O)(=O)N2CCCCC2)cn1 |
| InChI | InChI=1S/C20H31N5O2S/c1-15(18-14-25(20(3,4)5)23-16(18)2)22-19-10-9-17(13-21-19)28(26,27)24-11-7-6-8-12-24/h9-10,13-15H,6-8,11-12H2,1-5H3,(H,21,22) |
| InChIKey | KVRHOKDYBUVEEB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |