C21H29N3O5S — CID 55827922
5-piperidin-1-ylsulfonyl-N-[1-(3,4,5-trimethoxyphenyl)ethyl]pyridin-2-amine (PubChem CID 55827922) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is 5-piperidin-1-ylsulfonyl-N-[1-(3,4,5-trimethoxyphenyl)ethyl]pyridin-2-amine.
| Compound Name | 5-piperidin-1-ylsulfonyl-N-[1-(3,4,5-trimethoxyphenyl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 55827922 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 5-piperidin-1-ylsulfonyl-N-[1-(3,4,5-trimethoxyphenyl)ethyl]pyridin-2-amine |
| SMILES | COc1cc(C(C)Nc2ccc(S(=O)(=O)N3CCCCC3)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C21H29N3O5S/c1-15(16-12-18(27-2)21(29-4)19(13-16)28-3)23-20-9-8-17(14-22-20)30(25,26)24-10-6-5-7-11-24/h8-9,12-15H,5-7,10-11H2,1-4H3,(H,22,23) |
| InChIKey | SNMSFZGPBAXDMV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |