C17H28N4O3S — CID 133386475
N-[1-(4-methylmorpholin-2-yl)ethyl]-5-piperidin-1-ylsulfonylpyridin-2-amine (PubChem CID 133386475) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[1-(4-methylmorpholin-2-yl)ethyl]-5-piperidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-[1-(4-methylmorpholin-2-yl)ethyl]-5-piperidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 133386475 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[1-(4-methylmorpholin-2-yl)ethyl]-5-piperidin-1-ylsulfonylpyridin-2-amine |
| SMILES | CC(Nc1ccc(S(=O)(=O)N2CCCCC2)cn1)C1CN(C)CCO1 |
| InChI | InChI=1S/C17H28N4O3S/c1-14(16-13-20(2)10-11-24-16)19-17-7-6-15(12-18-17)25(22,23)21-8-4-3-5-9-21/h6-7,12,14,16H,3-5,8-11,13H2,1-2H3,(H,18,19) |
| InChIKey | YVWAWFVDPPAXMR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |