C22H28N2O7S — CID 43873383
N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide (PubChem CID 43873383) has the molecular formula C22H28N2O7S and a molecular weight of 464.54 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 43873383 |
| Molecular Formula | C22H28N2O7S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide |
| SMILES | COc1ccc(C(C)NC(=O)COc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1OC |
| InChI | InChI=1S/C22H28N2O7S/c1-16(17-4-9-20(28-2)21(14-17)29-3)23-22(25)15-31-18-5-7-19(8-6-18)32(26,27)24-10-12-30-13-11-24/h4-9,14,16H,10-13,15H2,1-3H3,(H,23,25) |
| InChIKey | NEJGQJTYZHIEBG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |