C22H27ClN2O5S — CID 30395314
2-chloro-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 30395314) has the molecular formula C22H27ClN2O5S and a molecular weight of 466.99 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 30395314 |
| Molecular Formula | C22H27ClN2O5S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-chloro-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2Cl)cc1OC |
| InChI | InChI=1S/C22H27ClN2O5S/c1-15(16-7-10-20(29-2)21(13-16)30-3)24-22(26)18-14-17(8-9-19(18)23)31(27,28)25-11-5-4-6-12-25/h7-10,13-15H,4-6,11-12H2,1-3H3,(H,24,26)/t15-/m1/s1 |
| InChIKey | OQFNNIPJGGCUMV-OAHLLOKOSA-N |
| XLogP | 4.02 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |