C23H29ClN2O3S — CID 133162556
5-(azepan-1-ylsulfonyl)-2-chloro-N-[1-(4-ethylphenyl)ethyl]benzamide (PubChem CID 133162556) has the molecular formula C23H29ClN2O3S and a molecular weight of 449.02 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-chloro-N-[1-(4-ethylphenyl)ethyl]benzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-chloro-N-[1-(4-ethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 133162556 |
| Molecular Formula | C23H29ClN2O3S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-chloro-N-[1-(4-ethylphenyl)ethyl]benzamide |
| SMILES | CCc1ccc(C(C)NC(=O)c2cc(S(=O)(=O)N3CCCCCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H29ClN2O3S/c1-3-18-8-10-19(11-9-18)17(2)25-23(27)21-16-20(12-13-22(21)24)30(28,29)26-14-6-4-5-7-15-26/h8-13,16-17H,3-7,14-15H2,1-2H3,(H,25,27) |
| InChIKey | OEVYIKSLEWLXMC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |