C22H27ClN2O3S — CID 133218003
2-chloro-5-pyrrolidin-1-ylsulfonyl-N-[1-(2,4,5-trimethylphenyl)ethyl]benzamide (PubChem CID 133218003) has the molecular formula C22H27ClN2O3S and a molecular weight of 434.99 g/mol. Its IUPAC name is 2-chloro-5-pyrrolidin-1-ylsulfonyl-N-[1-(2,4,5-trimethylphenyl)ethyl]benzamide.
| Compound Name | 2-chloro-5-pyrrolidin-1-ylsulfonyl-N-[1-(2,4,5-trimethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 133218003 |
| Molecular Formula | C22H27ClN2O3S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-chloro-5-pyrrolidin-1-ylsulfonyl-N-[1-(2,4,5-trimethylphenyl)ethyl]benzamide |
| SMILES | Cc1cc(C)c(C(C)NC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Cl)cc1C |
| InChI | InChI=1S/C22H27ClN2O3S/c1-14-11-16(3)19(12-15(14)2)17(4)24-22(26)20-13-18(7-8-21(20)23)29(27,28)25-9-5-6-10-25/h7-8,11-13,17H,5-6,9-10H2,1-4H3,(H,24,26) |
| InChIKey | JTHMFUOSXFSWHI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |