C23H30N2O3S — CID 51533910
N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 51533910) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 51533910 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethylphenyl)ethyl]-2-methyl-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(C)c([C@H](C)NC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2C)c1 |
| InChI | InChI=1S/C23H30N2O3S/c1-16-8-9-17(2)21(14-16)19(4)24-23(26)22-15-20(11-10-18(22)3)29(27,28)25-12-6-5-7-13-25/h8-11,14-15,19H,5-7,12-13H2,1-4H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | VGHRNOMFLJXMFT-IBGZPJMESA-N |
| XLogP | 4.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |