C20H21ClF2N2O3S — CID 17479996
2-chloro-N-[1-(3,4-difluorophenyl)ethyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 17479996) has the molecular formula C20H21ClF2N2O3S and a molecular weight of 442.92 g/mol. Its IUPAC name is 2-chloro-N-[1-(3,4-difluorophenyl)ethyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[1-(3,4-difluorophenyl)ethyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 17479996 |
| Molecular Formula | C20H21ClF2N2O3S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-chloro-N-[1-(3,4-difluorophenyl)ethyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC(NC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H21ClF2N2O3S/c1-13(14-5-8-18(22)19(23)11-14)24-20(26)16-12-15(6-7-17(16)21)29(27,28)25-9-3-2-4-10-25/h5-8,11-13H,2-4,9-10H2,1H3,(H,24,26) |
| InChIKey | BXBHVRIDTWDZQL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |