C16H27N5O4S2 — CID 55519421
5-(4-methylpiperazin-1-yl)sulfonyl-N-(1-methylsulfonylpiperidin-4-yl)pyridin-2-amine (PubChem CID 55519421) has the molecular formula C16H27N5O4S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 5-(4-methylpiperazin-1-yl)sulfonyl-N-(1-methylsulfonylpiperidin-4-yl)pyridin-2-amine.
| Compound Name | 5-(4-methylpiperazin-1-yl)sulfonyl-N-(1-methylsulfonylpiperidin-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 55519421 |
| Molecular Formula | C16H27N5O4S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 5-(4-methylpiperazin-1-yl)sulfonyl-N-(1-methylsulfonylpiperidin-4-yl)pyridin-2-amine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC3CCN(S(C)(=O)=O)CC3)nc2)CC1 |
| InChI | InChI=1S/C16H27N5O4S2/c1-19-9-11-21(12-10-19)27(24,25)15-3-4-16(17-13-15)18-14-5-7-20(8-6-14)26(2,22)23/h3-4,13-14H,5-12H2,1-2H3,(H,17,18) |
| InChIKey | CHEBXIJEYVLSRF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |