C20H32N4O3S — CID 133376514
2-[4-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]piperidin-1-yl]cyclohexan-1-ol (PubChem CID 133376514) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-[4-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]piperidin-1-yl]cyclohexan-1-ol.
| Compound Name | 2-[4-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]piperidin-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 133376514 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-[4-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)amino]piperidin-1-yl]cyclohexan-1-ol |
| SMILES | O=S(=O)(c1ccc(NC2CCN(C3CCCCC3O)CC2)nc1)N1CCCC1 |
| InChI | InChI=1S/C20H32N4O3S/c25-19-6-2-1-5-18(19)23-13-9-16(10-14-23)22-20-8-7-17(15-21-20)28(26,27)24-11-3-4-12-24/h7-8,15-16,18-19,25H,1-6,9-14H2,(H,21,22) |
| InChIKey | VVPJUNOFTOWPOG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |