C20H32N4O3S — CID 133305299
N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]-5-piperidin-1-ylsulfonylpyridin-2-amine (PubChem CID 133305299) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]-5-piperidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]-5-piperidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 133305299 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]-5-piperidin-1-ylsulfonylpyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(NC2CCN(CC3CCOC3)CC2)nc1)N1CCCCC1 |
| InChI | InChI=1S/C20H32N4O3S/c25-28(26,24-9-2-1-3-10-24)19-4-5-20(21-14-19)22-18-6-11-23(12-7-18)15-17-8-13-27-16-17/h4-5,14,17-18H,1-3,6-13,15-16H2,(H,21,22) |
| InChIKey | DVOIESYPFGCLML-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |