C15H21N3O3S — CID 133322670
N-cyclohex-3-en-1-yl-5-morpholin-4-ylsulfonylpyridin-2-amine (PubChem CID 133322670) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-5-morpholin-4-ylsulfonylpyridin-2-amine.
| Compound Name | N-cyclohex-3-en-1-yl-5-morpholin-4-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 133322670 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-cyclohex-3-en-1-yl-5-morpholin-4-ylsulfonylpyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(NC2CC=CCC2)nc1)N1CCOCC1 |
| InChI | InChI=1S/C15H21N3O3S/c19-22(20,18-8-10-21-11-9-18)14-6-7-15(16-12-14)17-13-4-2-1-3-5-13/h1-2,6-7,12-13H,3-5,8-11H2,(H,16,17) |
| InChIKey | QFMIIXZSAFQZRK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|