C16H25N3O3S — CID 9311729
N-[(1S,2S)-2-methylcyclohexyl]-5-morpholin-4-ylsulfonylpyridin-2-amine (PubChem CID 9311729) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclohexyl]-5-morpholin-4-ylsulfonylpyridin-2-amine.
| Compound Name | N-[(1S,2S)-2-methylcyclohexyl]-5-morpholin-4-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 9311729 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclohexyl]-5-morpholin-4-ylsulfonylpyridin-2-amine |
| SMILES | C[C@H]1CCCC[C@@H]1Nc1ccc(S(=O)(=O)N2CCOCC2)cn1 |
| InChI | InChI=1S/C16H25N3O3S/c1-13-4-2-3-5-15(13)18-16-7-6-14(12-17-16)23(20,21)19-8-10-22-11-9-19/h6-7,12-13,15H,2-5,8-11H2,1H3,(H,17,18)/t13-,15-/m0/s1 |
| InChIKey | URECFMLYXNGWIZ-ZFWWWQNUSA-N |
| XLogP | 2.09 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |