C14H24N6O5S2 — CID 52987336
3,5-dimethyl-N'-(5-morpholin-4-ylsulfonyl-2-pyridinyl)pyrazolidine-4-sulfonohydrazide (PubChem CID 52987336) has the molecular formula C14H24N6O5S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 3,5-dimethyl-N'-(5-morpholin-4-ylsulfonyl-2-pyridinyl)pyrazolidine-4-sulfonohydrazide.
| Compound Name | 3,5-dimethyl-N'-(5-morpholin-4-ylsulfonyl-2-pyridinyl)pyrazolidine-4-sulfonohydrazide |
|---|---|
| PubChem CID | 52987336 |
| Molecular Formula | C14H24N6O5S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 3,5-dimethyl-N'-(5-morpholin-4-ylsulfonyl-2-pyridinyl)pyrazolidine-4-sulfonohydrazide |
| SMILES | CC1NNC(C)C1S(=O)(=O)NNc1ccc(S(=O)(=O)N2CCOCC2)cn1 |
| InChI | InChI=1S/C14H24N6O5S2/c1-10-14(11(2)17-16-10)26(21,22)19-18-13-4-3-12(9-15-13)27(23,24)20-5-7-25-8-6-20/h3-4,9-11,14,16-17,19H,5-8H2,1-2H3,(H,15,18) |
| InChIKey | DEHGMCMQZOITCZ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|