C15H23N3O4S — CID 7042964
(2S,6R)-2,6-dimethyl-4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)morpholine (PubChem CID 7042964) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)morpholine.
| Compound Name | (2S,6R)-2,6-dimethyl-4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)morpholine |
|---|---|
| PubChem CID | 7042964 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-(5-morpholin-4-ylsulfonyl-2-pyridinyl)morpholine |
| SMILES | C[C@@H]1CN(c2ccc(S(=O)(=O)N3CCOCC3)cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H23N3O4S/c1-12-10-17(11-13(2)22-12)15-4-3-14(9-16-15)23(19,20)18-5-7-21-8-6-18/h3-4,9,12-13H,5-8,10-11H2,1-2H3/t12-,13+ |
| InChIKey | FSWIUHNGXHCFLH-BETUJISGSA-N |
| XLogP | 0.72 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |