C11H16N2O4S — CID 87659829
6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-3-sulfonic acid (PubChem CID 87659829) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-3-sulfonic acid.
| Compound Name | 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 87659829 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-3-sulfonic acid |
| SMILES | C[C@@H]1CN(c2ccc(S(=O)(=O)O)cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C11H16N2O4S/c1-8-6-13(7-9(2)17-8)11-4-3-10(5-12-11)18(14,15)16/h3-5,8-9H,6-7H2,1-2H3,(H,14,15,16)/t8-,9+ |
| InChIKey | IJOVSTCCXZBHDU-DTORHVGOSA-N |
| XLogP | 0.94 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|