C19H24N4O4S — CID 166181004
N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-(methylsulfamoyl)benzamide (PubChem CID 166181004) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-(methylsulfamoyl)benzamide.
| Compound Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 166181004 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)Nc2ccc(N3CC(C)OC(C)C3)nc2)cc1 |
| InChI | InChI=1S/C19H24N4O4S/c1-13-11-23(12-14(2)27-13)18-9-6-16(10-21-18)22-19(24)15-4-7-17(8-5-15)28(25,26)20-3/h4-10,13-14,20H,11-12H2,1-3H3,(H,22,24) |
| InChIKey | FCHHAYJTHBLMGY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |