C19H24N4O4S — CID 56510821
N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56510821) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56510821 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-2-(4-sulfamoylphenyl)acetamide |
| SMILES | CC1CN(c2ccc(NC(=O)Cc3ccc(S(N)(=O)=O)cc3)cn2)CC(C)O1 |
| InChI | InChI=1S/C19H24N4O4S/c1-13-11-23(12-14(2)27-13)18-8-5-16(10-21-18)22-19(24)9-15-3-6-17(7-4-15)28(20,25)26/h3-8,10,13-14H,9,11-12H2,1-2H3,(H,22,24)(H2,20,25,26) |
| InChIKey | KHUYGSKJXJQKSL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |