C20H24FN3O4S — CID 56511710
N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56511710) has the molecular formula C20H24FN3O4S and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56511710 |
| Molecular Formula | C20H24FN3O4S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-2-(4-sulfamoylphenyl)acetamide |
| SMILES | CC1CN(c2ccc(NC(=O)Cc3ccc(S(N)(=O)=O)cc3)cc2F)CC(C)O1 |
| InChI | InChI=1S/C20H24FN3O4S/c1-13-11-24(12-14(2)28-13)19-8-5-16(10-18(19)21)23-20(25)9-15-3-6-17(7-4-15)29(22,26)27/h3-8,10,13-14H,9,11-12H2,1-2H3,(H,23,25)(H2,22,26,27) |
| InChIKey | LHIJHVBNPVYLPW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|