C18H19ClF2N2O3S — CID 51963341
3-chloro-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-4-fluorobenzenesulfonamide (PubChem CID 51963341) has the molecular formula C18H19ClF2N2O3S and a molecular weight of 416.88 g/mol. Its IUPAC name is 3-chloro-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-chloro-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 51963341 |
| Molecular Formula | C18H19ClF2N2O3S |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 3-chloro-N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-4-fluorobenzenesulfonamide |
| SMILES | C[C@H]1CN(c2ccc(NS(=O)(=O)c3ccc(F)c(Cl)c3)cc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C18H19ClF2N2O3S/c1-11-9-23(10-12(2)26-11)18-6-3-13(7-17(18)21)22-27(24,25)14-4-5-16(20)15(19)8-14/h3-8,11-12,22H,9-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | BREJORDVNZMRDB-RYUDHWBXSA-N |
| XLogP | 4.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|