C15H12ClFN2O4S — CID 57385924
N-(3-chloro-4-fluorophenyl)-4-methyl-2-oxo-3H-1,4-benzoxazine-6-sulfonamide (PubChem CID 57385924) has the molecular formula C15H12ClFN2O4S and a molecular weight of 370.79 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-methyl-2-oxo-3H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-methyl-2-oxo-3H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 57385924 |
| Molecular Formula | C15H12ClFN2O4S |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-methyl-2-oxo-3H-1,4-benzoxazine-6-sulfonamide |
| SMILES | CN1CC(=O)Oc2ccc(S(=O)(=O)Nc3ccc(F)c(Cl)c3)cc21 |
| InChI | InChI=1S/C15H12ClFN2O4S/c1-19-8-15(20)23-14-5-3-10(7-13(14)19)24(21,22)18-9-2-4-12(17)11(16)6-9/h2-7,18H,8H2,1H3 |
| InChIKey | FMPWUTRUOZIOCH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|