C21H27ClFNO2S — CID 3407312
N-(3-chloro-4-fluorophenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 3407312) has the molecular formula C21H27ClFNO2S and a molecular weight of 411.97 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3407312 |
| Molecular Formula | C21H27ClFNO2S |
| Molecular Weight | 411.97 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)Nc2ccc(F)c(Cl)c2)c(C(C)C)c1 |
| InChI | InChI=1S/C21H27ClFNO2S/c1-12(2)15-9-17(13(3)4)21(18(10-15)14(5)6)27(25,26)24-16-7-8-20(23)19(22)11-16/h7-14,24H,1-6H3 |
| InChIKey | IETCKXLOBVHMDW-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.97 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |