C22H30N2O3S — CID 3874725
3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]benzamide (PubChem CID 3874725) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]benzamide.
| Compound Name | 3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 3874725 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]benzamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)Nc2cccc(C(N)=O)c2)c(C(C)C)c1 |
| InChI | InChI=1S/C22H30N2O3S/c1-13(2)17-11-19(14(3)4)21(20(12-17)15(5)6)28(26,27)24-18-9-7-8-16(10-18)22(23)25/h7-15,24H,1-6H3,(H2,23,25) |
| InChIKey | USPRUVGEMVWMHK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |