C7H9N3O3S — CID 57051238
3-(sulfamoylamino)benzamide (PubChem CID 57051238) has the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. Its IUPAC name is 3-(sulfamoylamino)benzamide.
| Compound Name | 3-(sulfamoylamino)benzamide |
|---|---|
| PubChem CID | 57051238 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 3-(sulfamoylamino)benzamide |
| SMILES | NC(=O)c1cccc(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C7H9N3O3S/c8-7(11)5-2-1-3-6(4-5)10-14(9,12)13/h1-4,10H,(H2,8,11)(H2,9,12,13) |
| InChIKey | SODCLZBZZGOJGY-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |