About 3-(methylamino)benzamide
3-(methylamino)benzamide (PubChem CID 18727714) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-(methylamino)benzamide.
Molecular Properties
| Compound Name | 3-(methylamino)benzamide |
| PubChem CID | 18727714 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3-(methylamino)benzamide |
| SMILES | CNc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C8H10N2O/c1-10-7-4-2-3-6(5-7)8(9)11/h2-5,10H,1H3,(H2,9,11) |
| InChIKey | NZZZOYVRPOWZJQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(methylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)benzamide?
The IUPAC name of 3-(methylamino)benzamide (CID 18727714) is 3-(methylamino)benzamide.
What is the SMILES notation for 3-(methylamino)benzamide?
The canonical SMILES for 3-(methylamino)benzamide is CNc1cccc(C(N)=O)c1.
What is the InChIKey of 3-(methylamino)benzamide?
The InChIKey is NZZZOYVRPOWZJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-10-7-4-2-3-6(5-7)8(9)11/h2-5,10H,1H3,(H2,9,11).
What are the key properties of 3-(methylamino)benzamide?
3-(methylamino)benzamide has a molecular weight of 150.18 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)benzamide is sourced from PubChem (CID 18727714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).