About 3-hydrazinylbenzamide;hydrochloride
3-hydrazinylbenzamide;hydrochloride (PubChem CID 90487444) has the molecular formula C7H10ClN3O
and a molecular weight of 187.63 g/mol. Its IUPAC name is 3-hydrazinylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | 3-hydrazinylbenzamide;hydrochloride |
| PubChem CID | 90487444 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 3-hydrazinylbenzamide;hydrochloride |
| SMILES | Cl.NNc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C7H9N3O.ClH/c8-7(11)5-2-1-3-6(4-5)10-9;/h1-4,10H,9H2,(H2,8,11);1H |
| InChIKey | DFRKFVOTXZCNNX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydrazinylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydrazinylbenzamide;hydrochloride?
The IUPAC name of 3-hydrazinylbenzamide;hydrochloride (CID 90487444) is 3-hydrazinylbenzamide;hydrochloride.
What is the SMILES notation for 3-hydrazinylbenzamide;hydrochloride?
The canonical SMILES for 3-hydrazinylbenzamide;hydrochloride is Cl.NNc1cccc(C(N)=O)c1.
What is the InChIKey of 3-hydrazinylbenzamide;hydrochloride?
The InChIKey is DFRKFVOTXZCNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O.ClH/c8-7(11)5-2-1-3-6(4-5)10-9;/h1-4,10H,9H2,(H2,8,11);1H.
What are the key properties of 3-hydrazinylbenzamide;hydrochloride?
3-hydrazinylbenzamide;hydrochloride has a molecular weight of 187.63 g/mol, XLogP of 0.49, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinylbenzamide;hydrochloride is sourced from PubChem (CID 90487444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).