About 3-(cyanoamino)benzamide
3-(cyanoamino)benzamide (PubChem CID 19926828) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 3-(cyanoamino)benzamide.
Molecular Properties
| Compound Name | 3-(cyanoamino)benzamide |
| PubChem CID | 19926828 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 3-(cyanoamino)benzamide |
| SMILES | N#CNc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C8H7N3O/c9-5-11-7-3-1-2-6(4-7)8(10)12/h1-4,11H,(H2,10,12) |
| InChIKey | DVEYVQMLXDJFGE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyanoamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyanoamino)benzamide?
The IUPAC name of 3-(cyanoamino)benzamide (CID 19926828) is 3-(cyanoamino)benzamide.
What is the SMILES notation for 3-(cyanoamino)benzamide?
The canonical SMILES for 3-(cyanoamino)benzamide is N#CNc1cccc(C(N)=O)c1.
What is the InChIKey of 3-(cyanoamino)benzamide?
The InChIKey is DVEYVQMLXDJFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-5-11-7-3-1-2-6(4-7)8(10)12/h1-4,11H,(H2,10,12).
What are the key properties of 3-(cyanoamino)benzamide?
3-(cyanoamino)benzamide has a molecular weight of 161.16 g/mol, XLogP of 0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyanoamino)benzamide is sourced from PubChem (CID 19926828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).