About ethyl 3-(cyanoamino)benzoate
ethyl 3-(cyanoamino)benzoate (PubChem CID 130015353) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is ethyl 3-(cyanoamino)benzoate.
Molecular Properties
| Compound Name | ethyl 3-(cyanoamino)benzoate |
| PubChem CID | 130015353 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | ethyl 3-(cyanoamino)benzoate |
| SMILES | CCOC(=O)c1cccc(NC#N)c1 |
| InChI | InChI=1S/C10H10N2O2/c1-2-14-10(13)8-4-3-5-9(6-8)12-7-11/h3-6,12H,2H2,1H3 |
| InChIKey | IOKMGFOMMAOUNM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(cyanoamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(cyanoamino)benzoate?
The IUPAC name of ethyl 3-(cyanoamino)benzoate (CID 130015353) is ethyl 3-(cyanoamino)benzoate.
What is the SMILES notation for ethyl 3-(cyanoamino)benzoate?
The canonical SMILES for ethyl 3-(cyanoamino)benzoate is CCOC(=O)c1cccc(NC#N)c1.
What is the InChIKey of ethyl 3-(cyanoamino)benzoate?
The InChIKey is IOKMGFOMMAOUNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-2-14-10(13)8-4-3-5-9(6-8)12-7-11/h3-6,12H,2H2,1H3.
What are the key properties of ethyl 3-(cyanoamino)benzoate?
ethyl 3-(cyanoamino)benzoate has a molecular weight of 190.20 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(cyanoamino)benzoate is sourced from PubChem (CID 130015353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).