C20H25NO4S — CID 19683974
ethyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]benzoate (PubChem CID 19683974) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is ethyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]benzoate.
| Compound Name | ethyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 19683974 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NS(=O)(=O)c2c(C)c(C)c(C)c(C)c2C)c1 |
| InChI | InChI=1S/C20H25NO4S/c1-7-25-20(22)17-9-8-10-18(11-17)21-26(23,24)19-15(5)13(3)12(2)14(4)16(19)6/h8-11,21H,7H2,1-6H3 |
| InChIKey | AICRUKHLLPVPBF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |