C30H37NO4S — CID 68691726
2-[2-[3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68691726) has the molecular formula C30H37NO4S and a molecular weight of 507.70 g/mol. Its IUPAC name is 2-[2-[3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 2-[2-[3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68691726 |
| Molecular Formula | C30H37NO4S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 2-[2-[3-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)Nc2cccc(CCc3ccccc3C(=O)O)c2)c(C(C)C)c1 |
| InChI | InChI=1S/C30H37NO4S/c1-19(2)24-17-27(20(3)4)29(28(18-24)21(5)6)36(34,35)31-25-12-9-10-22(16-25)14-15-23-11-7-8-13-26(23)30(32)33/h7-13,16-21,31H,14-15H2,1-6H3,(H,32,33) |
| InChIKey | IIQILTDVECONDS-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |